C22H46O3Si2 — CID 11338982
(3S,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloct-7-enal (PubChem CID 11338982) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is (3S,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloct-7-enal.
| Compound Name | (3S,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloct-7-enal |
|---|---|
| PubChem CID | 11338982 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (3S,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloct-7-enal |
| SMILES | C=C(C)C(O[Si](C)(C)C(C)(C)C)[C@H](C[C@H](C)CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O3Si2/c1-17(2)20(25-27(12,13)22(7,8)9)19(16-18(3)14-15-23)24-26(10,11)21(4,5)6/h15,18-20H,1,14,16H2,2-13H3/t18-,19+,20?/m1/s1 |
| InChIKey | QFMRUZQPKVWNSR-LFPSWIHMSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|