C17H25Cl — CID 113390416
1-(3-chloro-3-cyclopentylpropyl)-4-propan-2-ylbenzene (PubChem CID 113390416) has the molecular formula C17H25Cl and a molecular weight of 264.84 g/mol. Its IUPAC name is 1-(3-chloro-3-cyclopentylpropyl)-4-propan-2-ylbenzene.
| Compound Name | 1-(3-chloro-3-cyclopentylpropyl)-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 113390416 |
| Molecular Formula | C17H25Cl |
| Molecular Weight | 264.84 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(3-chloro-3-cyclopentylpropyl)-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(CCC(Cl)C2CCCC2)cc1 |
| InChI | InChI=1S/C17H25Cl/c1-13(2)15-10-7-14(8-11-15)9-12-17(18)16-5-3-4-6-16/h7-8,10-11,13,16-17H,3-6,9,12H2,1-2H3 |
| InChIKey | WQHRQJKORMUADP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|