C12H14N4S — CID 113390538
6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 113390538) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine.
| Compound Name | 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113390538 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(C2CCCC2)nc(-c2nccs2)n1 |
| InChI | InChI=1S/C12H14N4S/c13-10-7-9(8-3-1-2-4-8)15-11(16-10)12-14-5-6-17-12/h5-8H,1-4H2,(H2,13,15,16) |
| InChIKey | IJPWELPJXLZZAO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |