About 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine
6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 113390538) has the molecular formula C12H14N4S
and a molecular weight of 246.34 g/mol. Its IUPAC name is 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine |
| PubChem CID | 113390538 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(C2CCCC2)nc(-c2nccs2)n1 |
| InChI | InChI=1S/C12H14N4S/c13-10-7-9(8-3-1-2-4-8)15-11(16-10)12-14-5-6-17-12/h5-8H,1-4H2,(H2,13,15,16) |
| InChIKey | IJPWELPJXLZZAO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine?
The IUPAC name of 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine (CID 113390538) is 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine.
What is the SMILES notation for 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine?
The canonical SMILES for 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine is Nc1cc(C2CCCC2)nc(-c2nccs2)n1.
What is the InChIKey of 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine?
The InChIKey is IJPWELPJXLZZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4S/c13-10-7-9(8-3-1-2-4-8)15-11(16-10)12-14-5-6-17-12/h5-8H,1-4H2,(H2,13,15,16).
What are the key properties of 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine?
6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine has a molecular weight of 246.34 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine is sourced from PubChem (CID 113390538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).