C16H23F5N2O5 — CID 11339077
(2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 11339077) has the molecular formula C16H23F5N2O5 and a molecular weight of 418.36 g/mol. Its IUPAC name is (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11339077 |
| Molecular Formula | C16H23F5N2O5 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (2R,4S,5R)-5-[(1S)-1-acetamido-3-methylbutyl]-4-(2,2-difluoroethenyl)pyrrolidine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1C=C(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22F2N2O3.C2HF3O2/c1-7(2)4-10(17-8(3)19)13-9(6-12(15)16)5-11(18-13)14(20)21;3-2(4,5)1(6)7/h6-7,9-11,13,18H,4-5H2,1-3H3,(H,17,19)(H,20,21);(H,6,7)/t9-,10-,11+,13+;/m0./s1 |
| InChIKey | HGXMBGWJWKAMFB-CRLUJDQXSA-N |
| XLogP | 2.38 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |