C15H28O2 — CID 113391295
1-(3,5-dimethylcyclohexyl)-2-(oxan-2-yl)ethanol (PubChem CID 113391295) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2-(oxan-2-yl)ethanol.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2-(oxan-2-yl)ethanol |
|---|---|
| PubChem CID | 113391295 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-(oxan-2-yl)ethanol |
| SMILES | CC1CC(C)CC(C(O)CC2CCCCO2)C1 |
| InChI | InChI=1S/C15H28O2/c1-11-7-12(2)9-13(8-11)15(16)10-14-5-3-4-6-17-14/h11-16H,3-10H2,1-2H3 |
| InChIKey | XINRAAAJEJWLDK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |