C17H11ClFN5OS2 — CID 11339143
5-(5-chloro-2-fluorophenyl)-3-(3-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-7-yl)-1,2,4-oxadiazole (PubChem CID 11339143) has the molecular formula C17H11ClFN5OS2 and a molecular weight of 419.89 g/mol. Its IUPAC name is 5-(5-chloro-2-fluorophenyl)-3-(3-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-7-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(5-chloro-2-fluorophenyl)-3-(3-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-7-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 11339143 |
| Molecular Formula | C17H11ClFN5OS2 |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 5-(5-chloro-2-fluorophenyl)-3-(3-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3]thiazin-7-yl)-1,2,4-oxadiazole |
| SMILES | Fc1ccc(Cl)cc1-c1nc(C2CCn3c(nnc3-c3cccs3)S2)no1 |
| InChI | InChI=1S/C17H11ClFN5OS2/c18-9-3-4-11(19)10(8-9)16-20-14(23-25-16)12-5-6-24-15(13-2-1-7-26-13)21-22-17(24)27-12/h1-4,7-8,12H,5-6H2 |
| InChIKey | UAUWITXUFVELMI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |