C13H23N3O — CID 113391490
3-[3-methoxy-1-(propylamino)butyl]pyridin-4-amine (PubChem CID 113391490) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[3-methoxy-1-(propylamino)butyl]pyridin-4-amine.
| Compound Name | 3-[3-methoxy-1-(propylamino)butyl]pyridin-4-amine |
|---|---|
| PubChem CID | 113391490 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-[3-methoxy-1-(propylamino)butyl]pyridin-4-amine |
| SMILES | CCCNC(CC(C)OC)c1cnccc1N |
| InChI | InChI=1S/C13H23N3O/c1-4-6-16-13(8-10(2)17-3)11-9-15-7-5-12(11)14/h5,7,9-10,13,16H,4,6,8H2,1-3H3,(H2,14,15) |
| InChIKey | NNBMQOJDPJEONO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |