C12H18ClN3OS — CID 113392188
2-chloro-1-[2-[methyl-(1-methylpiperidin-4-yl)amino]-1,3-thiazol-4-yl]ethanone (PubChem CID 113392188) has the molecular formula C12H18ClN3OS and a molecular weight of 287.82 g/mol. Its IUPAC name is 2-chloro-1-[2-[methyl-(1-methylpiperidin-4-yl)amino]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 2-chloro-1-[2-[methyl-(1-methylpiperidin-4-yl)amino]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 113392188 |
| Molecular Formula | C12H18ClN3OS |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-chloro-1-[2-[methyl-(1-methylpiperidin-4-yl)amino]-1,3-thiazol-4-yl]ethanone |
| SMILES | CN1CCC(N(C)c2nc(C(=O)CCl)cs2)CC1 |
| InChI | InChI=1S/C12H18ClN3OS/c1-15-5-3-9(4-6-15)16(2)12-14-10(8-18-12)11(17)7-13/h8-9H,3-7H2,1-2H3 |
| InChIKey | XVVXEUAVFGVVGP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|