C27H34O2S — CID 11339219
(3R,3aR,5S)-8-(benzenesulfinyl)-3a-methyl-5-phenylmethoxy-3-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-azulene (PubChem CID 11339219) has the molecular formula C27H34O2S and a molecular weight of 422.63 g/mol. Its IUPAC name is (3R,3aR,5S)-8-(benzenesulfinyl)-3a-methyl-5-phenylmethoxy-3-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-azulene.
| Compound Name | (3R,3aR,5S)-8-(benzenesulfinyl)-3a-methyl-5-phenylmethoxy-3-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-azulene |
|---|---|
| PubChem CID | 11339219 |
| Molecular Formula | C27H34O2S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (3R,3aR,5S)-8-(benzenesulfinyl)-3a-methyl-5-phenylmethoxy-3-propan-2-yl-2,3,4,5,6,7-hexahydro-1H-azulene |
| SMILES | CC(C)[C@H]1CCC2=C(S(=O)c3ccccc3)CC[C@H](OCc3ccccc3)C[C@@]21C |
| InChI | InChI=1S/C27H34O2S/c1-20(2)24-15-16-25-26(30(28)23-12-8-5-9-13-23)17-14-22(18-27(24,25)3)29-19-21-10-6-4-7-11-21/h4-13,20,22,24H,14-19H2,1-3H3/t22-,24+,27+,30?/m0/s1 |
| InChIKey | IHPIBVMWAAANJH-VEWIYTPZSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |