C10H12ClF3N2OS — CID 113392216
2-chloro-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazol-4-yl]ethanone (PubChem CID 113392216) has the molecular formula C10H12ClF3N2OS and a molecular weight of 300.73 g/mol. Its IUPAC name is 2-chloro-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 2-chloro-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 113392216 |
| Molecular Formula | C10H12ClF3N2OS |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-chloro-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(C)N(CC(F)(F)F)c1nc(C(=O)CCl)cs1 |
| InChI | InChI=1S/C10H12ClF3N2OS/c1-6(2)16(5-10(12,13)14)9-15-7(4-18-9)8(17)3-11/h4,6H,3,5H2,1-2H3 |
| InChIKey | KSJNEUMWPCMHBZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|