C13H15ClN2OS2 — CID 113392242
2-chloro-1-[2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1,3-thiazol-4-yl]ethanone (PubChem CID 113392242) has the molecular formula C13H15ClN2OS2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 2-chloro-1-[2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 2-chloro-1-[2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 113392242 |
| Molecular Formula | C13H15ClN2OS2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-chloro-1-[2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(Cc1cccs1)N(C)c1nc(C(=O)CCl)cs1 |
| InChI | InChI=1S/C13H15ClN2OS2/c1-9(6-10-4-3-5-18-10)16(2)13-15-11(8-19-13)12(17)7-14/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | WOZCUWOODCVBBX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|