C24H45N3O3 — CID 11339245
1,3,5-trimethyl-1-N,3-N,5-N-tris(2-methylpropyl)cyclohexane-1,3,5-tricarboxamide (PubChem CID 11339245) has the molecular formula C24H45N3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is 1,3,5-trimethyl-1-N,3-N,5-N-tris(2-methylpropyl)cyclohexane-1,3,5-tricarboxamide.
| Compound Name | 1,3,5-trimethyl-1-N,3-N,5-N-tris(2-methylpropyl)cyclohexane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 11339245 |
| Molecular Formula | C24H45N3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | 1,3,5-trimethyl-1-N,3-N,5-N-tris(2-methylpropyl)cyclohexane-1,3,5-tricarboxamide |
| SMILES | CC(C)CNC(=O)C1(C)CC(C)(C(=O)NCC(C)C)CC(C)(C(=O)NCC(C)C)C1 |
| InChI | InChI=1S/C24H45N3O3/c1-16(2)10-25-19(28)22(7)13-23(8,20(29)26-11-17(3)4)15-24(9,14-22)21(30)27-12-18(5)6/h16-18H,10-15H2,1-9H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | RTBOFCHXSRLNHL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |