About ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate
ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate (PubChem CID 11339351) has the molecular formula C24H33N3O4
and a molecular weight of 427.55 g/mol. Its IUPAC name is ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate |
| PubChem CID | 11339351 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1CCN(CCN2C(=O)CC3(CCCC3)CC2=O)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-2-31-23(30)19-7-3-4-8-20(19)26-14-11-25(12-15-26)13-16-27-21(28)17-24(18-22(27)29)9-5-6-10-24/h3-4,7-8H,2,5-6,9-18H2,1H3 |
| InChIKey | SXINCFMIBHSDBJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate?
The IUPAC name of ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate (CID 11339351) is ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate.
What is the SMILES notation for ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate?
The canonical SMILES for ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate is CCOC(=O)c1ccccc1N1CCN(CCN2C(=O)CC3(CCCC3)CC2=O)CC1.
What is the InChIKey of ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate?
The InChIKey is SXINCFMIBHSDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N3O4/c1-2-31-23(30)19-7-3-4-8-20(19)26-14-11-25(12-15-26)13-16-27-21(28)17-24(18-22(27)29)9-5-6-10-24/h3-4,7-8H,2,5-6,9-18H2,1H3.
What are the key properties of ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate?
ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate has a molecular weight of 427.55 g/mol, XLogP of 2.69, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)ethyl]piperazin-1-yl]benzoate is sourced from PubChem (CID 11339351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).