About 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid
5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid (PubChem CID 113394284) has the molecular formula C10H6FN5O2
and a molecular weight of 247.19 g/mol. Its IUPAC name is 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid |
| PubChem CID | 113394284 |
| Molecular Formula | C10H6FN5O2 |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid |
| SMILES | N#Cc1ncn(-c2cc(F)c(C(=O)O)cc2N)n1 |
| InChI | InChI=1S/C10H6FN5O2/c11-6-2-8(7(13)1-5(6)10(17)18)16-4-14-9(3-12)15-16/h1-2,4H,13H2,(H,17,18) |
| InChIKey | GVPHTFIJKSBHLG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid?
The IUPAC name of 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid (CID 113394284) is 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid.
What is the SMILES notation for 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid?
The canonical SMILES for 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid is N#Cc1ncn(-c2cc(F)c(C(=O)O)cc2N)n1.
What is the InChIKey of 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid?
The InChIKey is GVPHTFIJKSBHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FN5O2/c11-6-2-8(7(13)1-5(6)10(17)18)16-4-14-9(3-12)15-16/h1-2,4H,13H2,(H,17,18).
What are the key properties of 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid?
5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid has a molecular weight of 247.19 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(3-cyano-1,2,4-triazol-1-yl)-2-fluorobenzoic acid is sourced from PubChem (CID 113394284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).