C13H15Br2N3 — CID 113394590
7-bromo-N-(2-bromoethyl)-N-propan-2-yl-1,5-naphthyridin-4-amine (PubChem CID 113394590) has the molecular formula C13H15Br2N3 and a molecular weight of 373.09 g/mol. Its IUPAC name is 7-bromo-N-(2-bromoethyl)-N-propan-2-yl-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-(2-bromoethyl)-N-propan-2-yl-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 113394590 |
| Molecular Formula | C13H15Br2N3 |
| Molecular Weight | 373.09 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 7-bromo-N-(2-bromoethyl)-N-propan-2-yl-1,5-naphthyridin-4-amine |
| SMILES | CC(C)N(CCBr)c1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C13H15Br2N3/c1-9(2)18(6-4-14)12-3-5-16-11-7-10(15)8-17-13(11)12/h3,5,7-9H,4,6H2,1-2H3 |
| InChIKey | UNRKTBYBWCJNNR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.09 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|