C21H40O7Si — CID 11339470
[(2R,3R,4aR,7S,8R,8aS)-2,3-dimethoxy-7-(methoxymethoxy)-2,3-dimethyl-6-methylidene-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11339470) has the molecular formula C21H40O7Si and a molecular weight of 432.63 g/mol. Its IUPAC name is [(2R,3R,4aR,7S,8R,8aS)-2,3-dimethoxy-7-(methoxymethoxy)-2,3-dimethyl-6-methylidene-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4aR,7S,8R,8aS)-2,3-dimethoxy-7-(methoxymethoxy)-2,3-dimethyl-6-methylidene-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11339470 |
| Molecular Formula | C21H40O7Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(2R,3R,4aR,7S,8R,8aS)-2,3-dimethoxy-7-(methoxymethoxy)-2,3-dimethyl-6-methylidene-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1C[C@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OCOC |
| InChI | InChI=1S/C21H40O7Si/c1-14-12-15-17(27-21(6,24-9)20(5,23-8)26-15)18(16(14)25-13-22-7)28-29(10,11)19(2,3)4/h15-18H,1,12-13H2,2-11H3/t15-,16+,17+,18-,20-,21-/m1/s1 |
| InChIKey | VXPUOASXYKDKAR-ORAJIYJMSA-N |
| XLogP | 3.84 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|