C22H23F3O6 — CID 11339649
(2S)-2-ethyl-5-[3-[4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3H-1-benzofuran-2-carboxylic acid (PubChem CID 11339649) has the molecular formula C22H23F3O6 and a molecular weight of 440.41 g/mol. Its IUPAC name is (2S)-2-ethyl-5-[3-[4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3H-1-benzofuran-2-carboxylic acid.
| Compound Name | (2S)-2-ethyl-5-[3-[4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3H-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 11339649 |
| Molecular Formula | C22H23F3O6 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (2S)-2-ethyl-5-[3-[4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3H-1-benzofuran-2-carboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)Cc2cc(OCCCOc3ccc(OCC(F)(F)F)cc3)ccc2O1 |
| InChI | InChI=1S/C22H23F3O6/c1-2-21(20(26)27)13-15-12-18(8-9-19(15)31-21)29-11-3-10-28-16-4-6-17(7-5-16)30-14-22(23,24)25/h4-9,12H,2-3,10-11,13-14H2,1H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | FCBSMBVOWOVEBM-NRFANRHFSA-N |
| XLogP | 4.64 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|