C12H14F2N2O — CID 113396529
N-(azetidin-3-yl)-2,4-difluoro-N,5-dimethylbenzamide (PubChem CID 113396529) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2,4-difluoro-N,5-dimethylbenzamide.
| Compound Name | N-(azetidin-3-yl)-2,4-difluoro-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 113396529 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-(azetidin-3-yl)-2,4-difluoro-N,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)C2CNC2)c(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O/c1-7-3-9(11(14)4-10(7)13)12(17)16(2)8-5-15-6-8/h3-4,8,15H,5-6H2,1-2H3 |
| InChIKey | ZCNRFFVUIFFXGG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |