C21H30F2N4O4 — CID 11339657
(2S)-N-(cyclopentylmethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 11339657) has the molecular formula C21H30F2N4O4 and a molecular weight of 440.49 g/mol. Its IUPAC name is (2S)-N-(cyclopentylmethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-(cyclopentylmethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 11339657 |
| Molecular Formula | C21H30F2N4O4 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (2S)-N-(cyclopentylmethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)Nc1cc(F)cc(F)c1)C(=O)N(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C21H30F2N4O4/c1-21(2,3)18(25-20(30)24-16-9-14(22)8-15(23)10-16)19(29)27(12-17(28)26-31)11-13-6-4-5-7-13/h8-10,13,18,31H,4-7,11-12H2,1-3H3,(H,26,28)(H2,24,25,30)/t18-/m1/s1 |
| InChIKey | AJAVBMXPKQJMJH-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|