C29H33NO3 — CID 11339728
(1R,2R,3R,8R)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 11339728) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is (1R,2R,3R,8R)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | (1R,2R,3R,8R)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 11339728 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (1R,2R,3R,8R)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | c1ccc(COC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]3CCCN32)cc1 |
| InChI | InChI=1S/C29H33NO3/c1-4-11-23(12-5-1)19-31-22-27-29(33-21-25-15-8-3-9-16-25)28(26-17-10-18-30(26)27)32-20-24-13-6-2-7-14-24/h1-9,11-16,26-29H,10,17-22H2/t26-,27-,28-,29-/m1/s1 |
| InChIKey | AMLVMYXZVMJMPZ-CXDXLJMYSA-N |
| XLogP | 5.22 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |