C22H41NO6Si — CID 11339731
ditert-butyl (2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylpyrrolidine-1,2-dicarboxylate (PubChem CID 11339731) has the molecular formula C22H41NO6Si and a molecular weight of 443.66 g/mol. Its IUPAC name is ditert-butyl (2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11339731 |
| Molecular Formula | C22H41NO6Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | ditert-butyl (2R,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-formylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](C=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H41NO6Si/c1-20(2,3)28-18(25)16-12-15(14-27-30(10,11)22(7,8)9)17(13-24)23(16)19(26)29-21(4,5)6/h13,15-17H,12,14H2,1-11H3/t15-,16+,17-/m0/s1 |
| InChIKey | HOBPPNSLILNSMN-BBWFWOEESA-N |
| XLogP | 4.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|