C21H36O8Si — CID 11339753
[(2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-6-yl]methyl acetate (PubChem CID 11339753) has the molecular formula C21H36O8Si and a molecular weight of 444.60 g/mol. Its IUPAC name is [(2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-6-yl]methyl acetate.
| Compound Name | [(2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-6-yl]methyl acetate |
|---|---|
| PubChem CID | 11339753 |
| Molecular Formula | C21H36O8Si |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [(2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-6-yl]methyl acetate |
| SMILES | CO[C@]1(C)O[C@H]2[C@H](O[C@@]1(C)OC)C(=O)C(COC(C)=O)=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O8Si/c1-13(22)26-12-14-11-15(29-30(9,10)19(2,3)4)17-18(16(14)23)28-21(6,25-8)20(5,24-7)27-17/h11,15,17-18H,12H2,1-10H3/t15-,17-,18-,20-,21-/m1/s1 |
| InChIKey | KTWZKMPYKLIWBR-CXCDTWTDSA-N |
| XLogP | 2.96 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|