C14H11Br2NO — CID 113398297
1-(3,5-dibromo-2-pyridinyl)-2-(3-methylphenyl)ethanone (PubChem CID 113398297) has the molecular formula C14H11Br2NO and a molecular weight of 369.06 g/mol. Its IUPAC name is 1-(3,5-dibromo-2-pyridinyl)-2-(3-methylphenyl)ethanone.
| Compound Name | 1-(3,5-dibromo-2-pyridinyl)-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 113398297 |
| Molecular Formula | C14H11Br2NO |
| Molecular Weight | 369.06 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | 1-(3,5-dibromo-2-pyridinyl)-2-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(CC(=O)c2ncc(Br)cc2Br)c1 |
| InChI | InChI=1S/C14H11Br2NO/c1-9-3-2-4-10(5-9)6-13(18)14-12(16)7-11(15)8-17-14/h2-5,7-8H,6H2,1H3 |
| InChIKey | OTSOGZUQIICUDV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.06 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |