C13H15BrN4 — CID 113398557
N-[(3-bromo-2-pyridinyl)-pyrazin-2-ylmethyl]propan-1-amine (PubChem CID 113398557) has the molecular formula C13H15BrN4 and a molecular weight of 307.19 g/mol. Its IUPAC name is N-[(3-bromo-2-pyridinyl)-pyrazin-2-ylmethyl]propan-1-amine.
| Compound Name | N-[(3-bromo-2-pyridinyl)-pyrazin-2-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 113398557 |
| Molecular Formula | C13H15BrN4 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-[(3-bromo-2-pyridinyl)-pyrazin-2-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1cnccn1)c1ncccc1Br |
| InChI | InChI=1S/C13H15BrN4/c1-2-5-17-13(11-9-15-7-8-16-11)12-10(14)4-3-6-18-12/h3-4,6-9,13,17H,2,5H2,1H3 |
| InChIKey | IKYOPNQDVBLYKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |