C10H14N4O2S — CID 113399539
(5-amino-1,3,4-thiadiazol-2-yl)-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone (PubChem CID 113399539) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is (5-amino-1,3,4-thiadiazol-2-yl)-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone.
| Compound Name | (5-amino-1,3,4-thiadiazol-2-yl)-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 113399539 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (5-amino-1,3,4-thiadiazol-2-yl)-(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methanone |
| SMILES | Nc1nnc(C(=O)N2CC3CCC(O)C3C2)s1 |
| InChI | InChI=1S/C10H14N4O2S/c11-10-13-12-8(17-10)9(16)14-3-5-1-2-7(15)6(5)4-14/h5-7,15H,1-4H2,(H2,11,13) |
| InChIKey | RPOSCGZIJQQYFY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |