C12H10ClFN2OS — CID 113400039
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-fluoro-2-methylbenzamide (PubChem CID 113400039) has the molecular formula C12H10ClFN2OS and a molecular weight of 284.74 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-fluoro-2-methylbenzamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 113400039 |
| Molecular Formula | C12H10ClFN2OS |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-fluoro-2-methylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C12H10ClFN2OS/c1-7-4-8(14)2-3-10(7)11(17)16-12-15-9(5-13)6-18-12/h2-4,6H,5H2,1H3,(H,15,16,17) |
| InChIKey | GQJYNPYYFITVIX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|