About ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate
ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate (PubChem CID 11340023) has the molecular formula C23H23BrN2O3
and a molecular weight of 455.35 g/mol. Its IUPAC name is ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate |
| PubChem CID | 11340023 |
| Molecular Formula | C23H23BrN2O3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c2cc(Br)c(CC3=NCCc4cc(OC)ccc43)cc12 |
| InChI | InChI=1S/C23H23BrN2O3/c1-4-29-23(27)22-13(2)26-21-12-19(24)15(10-18(21)22)11-20-17-6-5-16(28-3)9-14(17)7-8-25-20/h5-6,9-10,12,26H,4,7-8,11H2,1-3H3 |
| InChIKey | JCHYQKJYOXVRAP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate?
The IUPAC name of ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate (CID 11340023) is ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate.
What is the SMILES notation for ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate?
The canonical SMILES for ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate is CCOC(=O)c1c(C)[nH]c2cc(Br)c(CC3=NCCc4cc(OC)ccc43)cc12.
What is the InChIKey of ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate?
The InChIKey is JCHYQKJYOXVRAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23BrN2O3/c1-4-29-23(27)22-13(2)26-21-12-19(24)15(10-18(21)22)11-20-17-6-5-16(28-3)9-14(17)7-8-25-20/h5-6,9-10,12,26H,4,7-8,11H2,1-3H3.
What are the key properties of ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate?
ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate has a molecular weight of 455.35 g/mol, XLogP of 5.01, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-bromo-5-[(6-methoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-methyl-1H-indole-3-carboxylate is sourced from PubChem (CID 11340023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).