C12H18ClN3O2 — CID 113401015
1-[[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]cyclopentan-1-ol (PubChem CID 113401015) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 1-[[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 113401015 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-[[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]cyclopentan-1-ol |
| SMILES | COCc1nc(Cl)cc(NCC2(O)CCCC2)n1 |
| InChI | InChI=1S/C12H18ClN3O2/c1-18-7-11-15-9(13)6-10(16-11)14-8-12(17)4-2-3-5-12/h6,17H,2-5,7-8H2,1H3,(H,14,15,16) |
| InChIKey | YDXXYZKZOMEVIR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |