C29H33NO4 — CID 11340129
2-[6-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxolan-2-yl]-3-pyridinyl]cyclohexane-1,3-dione (PubChem CID 11340129) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-[6-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxolan-2-yl]-3-pyridinyl]cyclohexane-1,3-dione.
| Compound Name | 2-[6-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxolan-2-yl]-3-pyridinyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11340129 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 2-[6-[2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-1,3-dioxolan-2-yl]-3-pyridinyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc2c(cc1C1(c3ccc(C4C(=O)CCCC4=O)cn3)OCCO1)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C29H33NO4/c1-18-15-21-22(28(4,5)12-11-27(21,2)3)16-20(18)29(33-13-14-34-29)25-10-9-19(17-30-25)26-23(31)7-6-8-24(26)32/h9-12,15-17,26H,6-8,13-14H2,1-5H3 |
| InChIKey | BNECJQRTNRISFM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|