C25H37NO3SSi — CID 11340132
(1S,2R,6R,7Z,10E)-8-methyl-13-(4-methylphenyl)sulfonyl-5,5-di(propan-2-yl)-4-oxa-13-aza-5-silatricyclo[9.3.0.02,6]tetradeca-7,10-diene (PubChem CID 11340132) has the molecular formula C25H37NO3SSi and a molecular weight of 459.73 g/mol. Its IUPAC name is (1S,2R,6R,7Z,10E)-8-methyl-13-(4-methylphenyl)sulfonyl-5,5-di(propan-2-yl)-4-oxa-13-aza-5-silatricyclo[9.3.0.02,6]tetradeca-7,10-diene.
| Compound Name | (1S,2R,6R,7Z,10E)-8-methyl-13-(4-methylphenyl)sulfonyl-5,5-di(propan-2-yl)-4-oxa-13-aza-5-silatricyclo[9.3.0.02,6]tetradeca-7,10-diene |
|---|---|
| PubChem CID | 11340132 |
| Molecular Formula | C25H37NO3SSi |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (1S,2R,6R,7Z,10E)-8-methyl-13-(4-methylphenyl)sulfonyl-5,5-di(propan-2-yl)-4-oxa-13-aza-5-silatricyclo[9.3.0.02,6]tetradeca-7,10-diene |
| SMILES | C/C1=C/[C@@H]2[C@@H](CO[Si]2(C(C)C)C(C)C)[C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C/C2=C/C1 |
| InChI | InChI=1S/C25H37NO3SSi/c1-17(2)31(18(3)4)25-13-20(6)7-10-21-14-26(15-23(21)24(25)16-29-31)30(27,28)22-11-8-19(5)9-12-22/h8-13,17-18,23-25H,7,14-16H2,1-6H3/b20-13-,21-10-/t23-,24+,25-/m1/s1 |
| InChIKey | FYXJLKLPRYZNET-MQRZXRHISA-N |
| XLogP | 5.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|