C11H20N6O2 — CID 113401806
N-ethyl-2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]-methylamino]acetamide (PubChem CID 113401806) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-ethyl-2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]-methylamino]acetamide.
| Compound Name | N-ethyl-2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]-methylamino]acetamide |
|---|---|
| PubChem CID | 113401806 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-ethyl-2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]-methylamino]acetamide |
| SMILES | CCNC(=O)CN(C)c1cc(NN)nc(COC)n1 |
| InChI | InChI=1S/C11H20N6O2/c1-4-13-11(18)6-17(2)10-5-8(16-12)14-9(15-10)7-19-3/h5H,4,6-7,12H2,1-3H3,(H,13,18)(H,14,15,16) |
| InChIKey | HLHIDGUUEFDZOX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|