C12H23N3O3 — CID 113402708
methyl N-[1-(1-morpholin-2-ylethyl)pyrrolidin-3-yl]carbamate (PubChem CID 113402708) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl N-[1-(1-morpholin-2-ylethyl)pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-(1-morpholin-2-ylethyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 113402708 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | methyl N-[1-(1-morpholin-2-ylethyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(C)C2CNCCO2)C1 |
| InChI | InChI=1S/C12H23N3O3/c1-9(11-7-13-4-6-18-11)15-5-3-10(8-15)14-12(16)17-2/h9-11,13H,3-8H2,1-2H3,(H,14,16) |
| InChIKey | NEIXZSZWFFNIEZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |