About 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+)
1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) (PubChem CID 11340299) has the molecular formula C11H16N2O4PtS
and a molecular weight of 467.40 g/mol. Its IUPAC name is 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+).
Molecular Properties
| Compound Name | 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) |
| PubChem CID | 11340299 |
| Molecular Formula | C11H16N2O4PtS |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) |
| SMILES | CCCCn1ccnc1CSC.O=C([O-])C(=O)[O-].[Pt+2] |
| InChI | InChI=1S/C9H16N2S.C2H2O4.Pt/c1-3-4-6-11-7-5-10-9(11)8-12-2;3-1(4)2(5)6;/h5,7H,3-4,6,8H2,1-2H3;(H,3,4)(H,5,6);/q;;+2/p-2 |
| InChIKey | AJKNWAJLFKRVJN-UHFFFAOYSA-L |
| XLogP | -0.97 |
| TPSA | 98.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+)?
The IUPAC name of 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) (CID 11340299) is 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+).
What is the SMILES notation for 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+)?
The canonical SMILES for 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) is CCCCn1ccnc1CSC.O=C([O-])C(=O)[O-].[Pt+2].
What is the InChIKey of 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+)?
The InChIKey is AJKNWAJLFKRVJN-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H16N2S.C2H2O4.Pt/c1-3-4-6-11-7-5-10-9(11)8-12-2;3-1(4)2(5)6;/h5,7H,3-4,6,8H2,1-2H3;(H,3,4)(H,5,6);/q;;+2/p-2.
What are the key properties of 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+)?
1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) has a molecular weight of 467.40 g/mol, XLogP of -0.97, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(methylsulfanylmethyl)imidazole;oxalate;platinum(2+) is sourced from PubChem (CID 11340299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).