C21H25BrO7 — CID 11340346
(2R,3S)-5-bromo-7-methoxy-2-[3-methoxy-4-(methoxymethoxy)phenyl]-3-(methoxymethoxymethyl)-2,3-dihydro-1-benzofuran (PubChem CID 11340346) has the molecular formula C21H25BrO7 and a molecular weight of 469.33 g/mol. Its IUPAC name is (2R,3S)-5-bromo-7-methoxy-2-[3-methoxy-4-(methoxymethoxy)phenyl]-3-(methoxymethoxymethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | (2R,3S)-5-bromo-7-methoxy-2-[3-methoxy-4-(methoxymethoxy)phenyl]-3-(methoxymethoxymethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 11340346 |
| Molecular Formula | C21H25BrO7 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | (2R,3S)-5-bromo-7-methoxy-2-[3-methoxy-4-(methoxymethoxy)phenyl]-3-(methoxymethoxymethyl)-2,3-dihydro-1-benzofuran |
| SMILES | COCOC[C@@H]1c2cc(Br)cc(OC)c2O[C@H]1c1ccc(OCOC)c(OC)c1 |
| InChI | InChI=1S/C21H25BrO7/c1-23-11-27-10-16-15-8-14(22)9-19(26-4)21(15)29-20(16)13-5-6-17(28-12-24-2)18(7-13)25-3/h5-9,16,20H,10-12H2,1-4H3/t16-,20+/m1/s1 |
| InChIKey | JGKNHRPVJPAMEB-UZLBHIALSA-N |
| XLogP | 4.29 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|