About (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 11340394) has the molecular formula C20H15N5S
and a molecular weight of 357.44 g/mol. Its IUPAC name is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile |
| PubChem CID | 11340394 |
| Molecular Formula | C20H15N5S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1/Nc2ccccc2S1)c1ccnc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C20H15N5S/c21-12-15(19-24-17-8-4-5-9-18(17)26-19)16-10-11-22-20(25-16)23-13-14-6-2-1-3-7-14/h1-11,24H,13H2,(H,22,23,25)/b19-15+ |
| InChIKey | LZHAOXGGAMNMLT-XDJHFCHBSA-N |
| XLogP | 4.50 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile?
The IUPAC name of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile (CID 11340394) is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile.
What is the SMILES notation for (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile?
The canonical SMILES for (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile is N#C/C(=C1/Nc2ccccc2S1)c1ccnc(NCc2ccccc2)n1.
What is the InChIKey of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile?
The InChIKey is LZHAOXGGAMNMLT-XDJHFCHBSA-N. The full InChI is InChI=1S/C20H15N5S/c21-12-15(19-24-17-8-4-5-9-18(17)26-19)16-10-11-22-20(25-16)23-13-14-6-2-1-3-7-14/h1-11,24H,13H2,(H,22,23,25)/b19-15+.
What are the key properties of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile?
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile has a molecular weight of 357.44 g/mol, XLogP of 4.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(benzylamino)pyrimidin-4-yl]acetonitrile is sourced from PubChem (CID 11340394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).