About 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione
6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione (PubChem CID 113404202) has the molecular formula C12H14ClN3O2S
and a molecular weight of 299.78 g/mol. Its IUPAC name is 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 113404202 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1c(Cl)[nH]c(=O)n(C(CC)c2nccs2)c1=O |
| InChI | InChI=1S/C12H14ClN3O2S/c1-3-7-9(13)15-12(18)16(11(7)17)8(4-2)10-14-5-6-19-10/h5-6,8H,3-4H2,1-2H3,(H,15,18) |
| InChIKey | PVGRBULODAWTIN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione (CID 113404202) is 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione is CCc1c(Cl)[nH]c(=O)n(C(CC)c2nccs2)c1=O.
What is the InChIKey of 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione?
The InChIKey is PVGRBULODAWTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O2S/c1-3-7-9(13)15-12(18)16(11(7)17)8(4-2)10-14-5-6-19-10/h5-6,8H,3-4H2,1-2H3,(H,15,18).
What are the key properties of 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione?
6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione has a molecular weight of 299.78 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-ethyl-3-[1-(1,3-thiazol-2-yl)propyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 113404202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).