C14H15ClN2O2 — CID 113404314
3-butan-2-yl-6-chloro-5-phenyl-1H-pyrimidine-2,4-dione (PubChem CID 113404314) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 3-butan-2-yl-6-chloro-5-phenyl-1H-pyrimidine-2,4-dione.
| Compound Name | 3-butan-2-yl-6-chloro-5-phenyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113404314 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-butan-2-yl-6-chloro-5-phenyl-1H-pyrimidine-2,4-dione |
| SMILES | CCC(C)n1c(=O)[nH]c(Cl)c(-c2ccccc2)c1=O |
| InChI | InChI=1S/C14H15ClN2O2/c1-3-9(2)17-13(18)11(12(15)16-14(17)19)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,16,19) |
| InChIKey | ZIGVMLZIQGXWBJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |