C10H3Cl4FN2O2 — CID 113404427
6-chloro-5-fluoro-3-(2,4,5-trichlorophenyl)-1H-pyrimidine-2,4-dione (PubChem CID 113404427) has the molecular formula C10H3Cl4FN2O2 and a molecular weight of 343.96 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-(2,4,5-trichlorophenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-fluoro-3-(2,4,5-trichlorophenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113404427 |
| Molecular Formula | C10H3Cl4FN2O2 |
| Molecular Weight | 343.96 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | 6-chloro-5-fluoro-3-(2,4,5-trichlorophenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(Cl)c(F)c(=O)n1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H3Cl4FN2O2/c11-3-1-5(13)6(2-4(3)12)17-9(18)7(15)8(14)16-10(17)19/h1-2H,(H,16,19) |
| InChIKey | LYBRRBVXHSTBNC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|