C22H43NO6Si2 — CID 11340457
1-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-methyloxan-2-yl]pyrrolidine-2,5-dione (PubChem CID 11340457) has the molecular formula C22H43NO6Si2 and a molecular weight of 473.76 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-methyloxan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-methyloxan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11340457 |
| Molecular Formula | C22H43NO6Si2 |
| Molecular Weight | 473.76 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 1-[(2S,3S,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-6-methyloxan-2-yl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H]1O[C@H](N2C(=O)CCC2=O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43NO6Si2/c1-14-18(28-30(8,9)21(2,3)4)19(29-31(10,11)22(5,6)7)17(26)20(27-14)23-15(24)12-13-16(23)25/h14,17-20,26H,12-13H2,1-11H3/t14-,17-,18+,19-,20-/m0/s1 |
| InChIKey | MVDGSBMLTAPADL-ZQOVORKSSA-N |
| XLogP | 4.02 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|