About N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine
N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 113405301) has the molecular formula C13H20F2N2
and a molecular weight of 242.31 g/mol. Its IUPAC name is N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 113405301 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | Cc1ccc(F)c(CNCCNC(C)C)c1F |
| InChI | InChI=1S/C13H20F2N2/c1-9(2)17-7-6-16-8-11-12(14)5-4-10(3)13(11)15/h4-5,9,16-17H,6-8H2,1-3H3 |
| InChIKey | DGEQYJMRMWCLSN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine (CID 113405301) is N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine is Cc1ccc(F)c(CNCCNC(C)C)c1F.
What is the InChIKey of N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is DGEQYJMRMWCLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2/c1-9(2)17-7-6-16-8-11-12(14)5-4-10(3)13(11)15/h4-5,9,16-17H,6-8H2,1-3H3.
What are the key properties of N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine?
N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 242.31 g/mol, XLogP of 2.36, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-difluoro-3-methylphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 113405301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).