C13H24N2O2S — CID 113405955
2-[(4,4-dimethylthian-3-yl)amino]-1-morpholin-4-ylethanone (PubChem CID 113405955) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-[(4,4-dimethylthian-3-yl)amino]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(4,4-dimethylthian-3-yl)amino]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 113405955 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[(4,4-dimethylthian-3-yl)amino]-1-morpholin-4-ylethanone |
| SMILES | CC1(C)CCSCC1NCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H24N2O2S/c1-13(2)3-8-18-10-11(13)14-9-12(16)15-4-6-17-7-5-15/h11,14H,3-10H2,1-2H3 |
| InChIKey | ZTXDCIFHELWGLT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |