About 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide
2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide (PubChem CID 113408305) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide |
| PubChem CID | 113408305 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1cc(N)c(C)cn1 |
| InChI | InChI=1S/C13H22N4O/c1-5-17(6-2)13(18)10(4)16-12-7-11(14)9(3)8-15-12/h7-8,10H,5-6H2,1-4H3,(H3,14,15,16) |
| InChIKey | LFODUSFMOBGIPG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide?
The IUPAC name of 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide (CID 113408305) is 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)Nc1cc(N)c(C)cn1.
What is the InChIKey of 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide?
The InChIKey is LFODUSFMOBGIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O/c1-5-17(6-2)13(18)10(4)16-12-7-11(14)9(3)8-15-12/h7-8,10H,5-6H2,1-4H3,(H3,14,15,16).
What are the key properties of 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide?
2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide has a molecular weight of 250.35 g/mol, XLogP of 1.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-5-methyl-2-pyridinyl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 113408305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).