C11H18N2O6 — CID 113408335
2-[2-[(1-morpholin-4-yl-1-oxopropan-2-yl)amino]-2-oxoethoxy]acetic acid (PubChem CID 113408335) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[2-[(1-morpholin-4-yl-1-oxopropan-2-yl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(1-morpholin-4-yl-1-oxopropan-2-yl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 113408335 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-[2-[(1-morpholin-4-yl-1-oxopropan-2-yl)amino]-2-oxoethoxy]acetic acid |
| SMILES | CC(NC(=O)COCC(=O)O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O6/c1-8(11(17)13-2-4-18-5-3-13)12-9(14)6-19-7-10(15)16/h8H,2-7H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | PNLFJEWMGWZBPT-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |