C28H24N6O3 — CID 11340842
19-methyl-3-(2-methylpropyl)-7-pyrimidin-2-yloxy-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaene-12,14-dione (PubChem CID 11340842) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 19-methyl-3-(2-methylpropyl)-7-pyrimidin-2-yloxy-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaene-12,14-dione.
| Compound Name | 19-methyl-3-(2-methylpropyl)-7-pyrimidin-2-yloxy-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaene-12,14-dione |
|---|---|
| PubChem CID | 11340842 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 19-methyl-3-(2-methylpropyl)-7-pyrimidin-2-yloxy-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaene-12,14-dione |
| SMILES | CC(C)Cn1c2ccc(Oc3ncccn3)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3=O |
| InChI | InChI=1S/C28H24N6O3/c1-14(2)12-34-20-8-5-15(37-28-29-9-4-10-30-28)11-17(20)22-24-23(26(35)31-27(24)36)21-16(25(22)34)6-7-19-18(21)13-33(3)32-19/h4-5,8-11,13-14H,6-7,12H2,1-3H3,(H,31,35,36) |
| InChIKey | XCZKXKGTBNUKQN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|