About N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine
N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine (PubChem CID 113409063) has the molecular formula C13H20N2S2
and a molecular weight of 268.45 g/mol. Its IUPAC name is N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 113409063 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine |
| SMILES | CCCNCCN(C)Cc1cc2sccc2s1 |
| InChI | InChI=1S/C13H20N2S2/c1-3-5-14-6-7-15(2)10-11-9-13-12(17-11)4-8-16-13/h4,8-9,14H,3,5-7,10H2,1-2H3 |
| InChIKey | RVYINYABODMMNX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine?
The IUPAC name of N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine (CID 113409063) is N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine is CCCNCCN(C)Cc1cc2sccc2s1.
What is the InChIKey of N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine?
The InChIKey is RVYINYABODMMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2S2/c1-3-5-14-6-7-15(2)10-11-9-13-12(17-11)4-8-16-13/h4,8-9,14H,3,5-7,10H2,1-2H3.
What are the key properties of N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine?
N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine has a molecular weight of 268.45 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-propyl-N'-(thieno[3,2-b]thiophen-5-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 113409063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).