C26H27F3N6O — CID 11340929
N-cyano-N'-[2-(3,4-dimethylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 11340929) has the molecular formula C26H27F3N6O and a molecular weight of 496.54 g/mol. Its IUPAC name is N-cyano-N'-[2-(3,4-dimethylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N-cyano-N'-[2-(3,4-dimethylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 11340929 |
| Molecular Formula | C26H27F3N6O |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-cyano-N'-[2-(3,4-dimethylphenyl)ethyl]-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | Cc1ccc(CC/N=C(\NC#N)N2CC(N3CCCC3=O)C(c3ccc(C(F)(F)F)cc3)=N2)cc1C |
| InChI | InChI=1S/C26H27F3N6O/c1-17-5-6-19(14-18(17)2)11-12-31-25(32-16-30)35-15-22(34-13-3-4-23(34)36)24(33-35)20-7-9-21(10-8-20)26(27,28)29/h5-10,14,22H,3-4,11-13,15H2,1-2H3,(H,31,32) |
| InChIKey | FGCHGEVWGZBZSX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|