C26H33Cl2N5O — CID 11341046
4-[(N'-cyclohexyl-N-pyrrolidin-3-ylcarbamimidoyl)amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 11341046) has the molecular formula C26H33Cl2N5O and a molecular weight of 502.49 g/mol. Its IUPAC name is 4-[(N'-cyclohexyl-N-pyrrolidin-3-ylcarbamimidoyl)amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[(N'-cyclohexyl-N-pyrrolidin-3-ylcarbamimidoyl)amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 11341046 |
| Molecular Formula | C26H33Cl2N5O |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 4-[(N'-cyclohexyl-N-pyrrolidin-3-ylcarbamimidoyl)amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1ccc(N/C(=N/C2CCCCC2)NC2CCNC2)cc1 |
| InChI | InChI=1S/C26H33Cl2N5O/c27-20-9-6-18(24(28)16-20)12-15-30-25(34)19-7-10-22(11-8-19)32-26(33-23-13-14-29-17-23)31-21-4-2-1-3-5-21/h6-11,16,21,23,29H,1-5,12-15,17H2,(H,30,34)(H2,31,32,33) |
| InChIKey | PDXOBKQWULUDRV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|