C21H22ClF5N6O — CID 11341103
5-chloro-6-[2,6-difluoro-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11341103) has the molecular formula C21H22ClF5N6O and a molecular weight of 504.89 g/mol. Its IUPAC name is 5-chloro-6-[2,6-difluoro-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[2,6-difluoro-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11341103 |
| Molecular Formula | C21H22ClF5N6O |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 5-chloro-6-[2,6-difluoro-4-(3-pyrrolidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCN3CCCC3)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C21H22ClF5N6O/c1-12(21(25,26)27)30-19-17(18(22)31-20-28-11-29-33(19)20)16-14(23)9-13(10-15(16)24)34-8-4-7-32-5-2-3-6-32/h9-12,30H,2-8H2,1H3/t12-/m0/s1 |
| InChIKey | MEZUNAKNPOIBGG-LBPRGKRZSA-N |
| XLogP | 4.95 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|