C29H33ClN4O2 — CID 11341105
2-(1H-indol-3-yl)ethyl N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]carbamate (PubChem CID 11341105) has the molecular formula C29H33ClN4O2 and a molecular weight of 505.06 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethyl N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]carbamate.
| Compound Name | 2-(1H-indol-3-yl)ethyl N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 11341105 |
| Molecular Formula | C29H33ClN4O2 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 2-(1H-indol-3-yl)ethyl N-[5-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]pentyl]carbamate |
| SMILES | O=C(NCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)OCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H33ClN4O2/c30-21-12-13-24-27(18-21)34-26-11-5-3-9-23(26)28(24)31-15-6-1-7-16-32-29(35)36-17-14-20-19-33-25-10-4-2-8-22(20)25/h2,4,8,10,12-13,18-19,33H,1,3,5-7,9,11,14-17H2,(H,31,34)(H,32,35) |
| InChIKey | LYBXKEJTVIPNNF-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|