C12H16BrClN4O — CID 113411617
3-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-piperidin-1-ylpropan-1-one (PubChem CID 113411617) has the molecular formula C12H16BrClN4O and a molecular weight of 347.64 g/mol. Its IUPAC name is 3-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 113411617 |
| Molecular Formula | C12H16BrClN4O |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-[(5-bromo-2-chloropyrimidin-4-yl)amino]-1-piperidin-1-ylpropan-1-one |
| SMILES | O=C(CCNc1nc(Cl)ncc1Br)N1CCCCC1 |
| InChI | InChI=1S/C12H16BrClN4O/c13-9-8-16-12(14)17-11(9)15-5-4-10(19)18-6-2-1-3-7-18/h8H,1-7H2,(H,15,16,17) |
| InChIKey | JJCKUQQNYVQZMU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |